Zum Inhalt springen
Bibelstudium

1. Chronik 9

Unter jedem Vers steht der hebräische Grundtext Wort für Wort, von rechts nach links: jeder Vorsatz, Stamm und jede Endung mit Umschrift, englischer Bedeutung, erweiterter Strong-Nummer und Morphologie-Code. Grundtext: TAHOT von STEPBible (CC BY 4.0)

Tippen Sie auf ein Wort, um es im ganzen Kapitel zu markieren; ein Morphologie-Code erklärt sich ebenso (auf Englisch).

  1. 1So all Israel were reckoned by genealogies; and, behold, they are written in the book of the kings of Israel: and Judah was carried away captive to Babylon for their transgression.
    1. וְכָל־
      1. וְve.andH9002
      2. כָלkholallH3605
    2. יִשְׂרָאֵל֙
      1. יִשְׂרָאֵל֙Yis.ra.'ElIsraelH3478
    3. הִתְיַחְשׂ֔וּ
      1. הִתְיַחְשׂ֔וּhit.yach.Suthey had themselves enrolledH3187
    4. וְהִנָּ֣ם
      1. וְve.andH9002
      2. הִנָּ֣hi.NathereH2009
      3. םmtheyH9048
    5. כְּתוּבִ֔ים
      1. כְּתוּבִ֔יםke.tu.Vim[are] writtenH3789
    6. עַל־
      1. עַל'al-onH5921A
    7. סֵ֖פֶר
      1. סֵ֖פֶרSe.fer[the] scroll ofH5612H
    8. מַלְכֵ֣י
      1. מַלְכֵ֣יmal.Khei[the] kings ofH4428G
    9. יִשְׂרָאֵ֑ל
      1. יִשְׂרָאֵ֑לYis.ra.'ElIsraelH3478
    10. וִיהוּדָ֛ה
      1. וִvi.andH9002
      2. יהוּדָ֛הhu.DahJudahH3063G
    11. הָגְל֥וּ
      1. הָגְל֥וּha.ge.Luthey were taken into exileH1540K
    12. לְבָבֶ֖ל
      1. לְle.toH9005
      2. בָבֶ֖לva.VelBabylonH0894
    13. בְּמַעֲלָֽם׃
      1. בְּbe.inH9003
      2. מַעֲלָֽma.'a.LaunfaithfulnessH4604
      3. םmtheirH9028
  2. 2Now the first inhabitants that dwelt in their possessions in their cities were Israel, the priests, the Levites, and the Nethinim.
    1. וְהַיּוֹשְׁבִים֙
      1. וְve.andH9002
      2. הַhai.theH9009
      3. יּוֹשְׁבִים֙yo.she.ViminhabitantsH3427
    2. הָרִ֣אשֹׁנִ֔ים
      1. הָha.<the>H9009
      2. רִ֣אשֹׁנִ֔יםRi.sho.NimfirstH7223G
    3. אֲשֶׁ֥ר
      1. אֲשֶׁ֥ר'a.SherwhoH0834A
    4. בַּאֲחֻזָּתָ֖ם
      1. בַּba.[were] inH9003
      2. אֲחֻזָּתָ֖'a.chu.za.TapossessionH0272
      3. םmtheirH9028
    5. בְּעָרֵיהֶ֑ם
      1. בְּbe.inH9003
      2. עָרֵי'a.rei.citiesH5892B
      3. הֶ֑םHemtheirH9028
    6. יִשְׂרָאֵל֙
      1. יִשְׂרָאֵל֙Yis.ra.'El[were] IsraelH3478
    7. הַכֹּ֣הֲנִ֔ים
      1. הַha.theH9009
      2. כֹּ֣הֲנִ֔יםKo.ha.NimpriestsH3548
    8. הַלְוִיִּ֖ם
      1. הַhatheH9009
      2. לְוִיִּ֖םl.vi.YimLevitesH3881
    9. וְהַנְּתִינִֽים׃
      1. וְve.andH9002
      2. הַha.theH9009
      3. נְּתִינִֽיםne.ti.Nimtemple servantsH5411
  3. 3And in Jerusalem dwelt of the children of Judah, and of the children of Benjamin, and of the children of Ephraim and Manasseh:
    1. וּבִירוּשָׁלִַ֙ם֙
      1. וּu.andH9002
      2. בִvi.inH9003
      3. ירוּשָׁלִַ֙ם֙ru.sha.LimJerusalemH3389
    2. יָשְׁב֔וּ
      1. יָשְׁב֔וּya.she.Vuthey dweltH3427
    3. מִן־
      1. מִןmin-some ofH4480A
    4. בְּנֵ֥י
      1. בְּנֵ֥יbe.Nei[the] descendants ofH1121G
    5. יְהוּדָ֖ה
      1. יְהוּדָ֖הye.hu.DahJudahH3063G
    6. וּמִן־
      1. וּu.andH9002
      2. מִןmin-some ofH4480A
    7. בְּנֵ֣י
      1. בְּנֵ֣יbe.Nei[the] descendants ofH1121G
    8. בִנְיָמִ֑ן
      1. בִנְיָמִ֑ןvin.ya.MinBenjaminH1144G
    9. וּמִן־
      1. וּu.andH9002
      2. מִןmin-some ofH4480A
    10. בְּנֵ֥י
      1. בְּנֵ֥יbe.Nei[the] descendants ofH1121G
    11. אֶפְרַ֖יִם
      1. אֶפְרַ֖יִם'ef.Ra.yimEphraimH0669G
    12. וּמְנַשֶּֽׁה׃
      1. וּu.andH9002
      2. מְנַשֶּֽׁהme.na.ShehManassehH4519G
  4. 4Uthai the son of Ammihud, the son of Omri, the son of Imri, the son of Bani, of the children of Perez the son of Judah.
    1. עוּתַ֨י
      1. עוּתַ֨י'u.TaiUthaiH5793G
    2. בֶּן־
      1. בֶּןben-[the] son ofH1121A
    3. עַמִּיה֤וּד
      1. עַמִּיה֤וּד'a.mi.HudAmmihudH5989K
    4. בֶּן־
      1. בֶּןben-[the] son ofH1121A
    5. עָמְרִי֙
      1. עָמְרִי֙'a.me.RiOmriH6018I
    6. בֶּן־
      1. בֶּןben-[the] son ofH1121A
    7. אִמְרִ֣י
      1. אִמְרִ֣י'im.RiImriH0566G
    8. בֶן־
      1. בֶןven-[the] son ofH1121A
    9. בָּנִ֔י מִןQere, geschrieben (Ketiv): בִּנְיָמִן־
      1. בָּנִ֔יba.niBaniH1137I
      2. מִןminfromH4480A
    10. בְּנֵי־
      1. בְּנֵיbe.nei-[the] descendants ofH1121G
    11. פֶ֖רֶץ
      1. פֶ֖רֶץFe.retzPerezH6557
    12. בֶּן־
      1. בֶּןben-[the] son ofH1121A
    13. יְהוּדָֽה׃
      1. יְהוּדָֽהye.hu.DahJudahH3063G
  5. 5And of the Shilonites: Asaiah the first-born, and his sons.
    1. וּמִן־
      1. וּu.andH9002
      2. מִןmin-ofH4480A
    2. הַשִּׁ֣ילוֹנִ֔י
      1. הַha.theH9009
      2. שִּׁ֣ילוֹנִ֔יShi.lo.NiShilonite[s]H7888
    3. עֲשָׂיָ֥ה
      1. עֲשָׂיָ֥ה'a.sa.YahAsaiahH6222J
    4. הַבְּכ֖וֹר
      1. הַha.theH9009
      2. בְּכ֖וֹרbe.KhorfirstbornH1060
    5. וּבָנָֽיו׃
      1. וּu.andH9002
      2. בָנָֽיva.NasonsH1121A
      3. וvhisH9023
  6. 6And of the sons of Zerah: Jeuel, and their brethren, six hundred and ninety.
    1. וּמִן־
      1. וּu.andH9002
      2. מִןmin-ofH4480A
    2. בְּנֵי־
      1. בְּנֵיbe.nei-[the] descendants ofH1121A
    3. זֶ֖רַח
      1. זֶ֖רַחZe.rachZerahH2226I
    4. יְעוּאֵ֑ל
      1. יְעוּאֵ֑לye.'u.'ElJeuelH3262
    5. וַאֲחֵיהֶ֖ם
      1. וַva.andH9002
      2. אֲחֵי'a.chei.relativesH0251H
      3. הֶ֖םHemtheirH9028
    6. שֵׁשׁ־
      1. שֵׁשׁshesh-sixH8337
    7. מֵא֥וֹת
      1. מֵא֥וֹתme.'othundred<s>H3967
    8. וְתִשְׁעִֽים׃
      1. וְve.andH9002
      2. תִשְׁעִֽיםtish.'ImninetyH8673
  7. 7And of the sons of Benjamin: Sallu the son of Meshullam, the son of Hodaviah, the son of Hassenuah,
    1. וּמִן־
      1. וּu.andH9002
      2. מִןmin-ofH4480A
    2. בְּנֵ֖י
      1. בְּנֵ֖יbe.Nei[the] descendants ofH1121G
    3. בִּנְיָמִ֑ן
      1. בִּנְיָמִ֑ןbin.ya.MinBenjaminH1144G
    4. סַלּוּא֙
      1. סַלּוּא֙sa.Lu'SalluH5543D
    5. בֶּן־
      1. בֶּןben-[the] son ofH1121A
    6. מְשֻׁלָּ֔ם
      1. מְשֻׁלָּ֔םme.shu.LamMeshullamH4918K
    7. בֶּן־
      1. בֶּןben-[the] son ofH1121A
    8. הוֹדַוְיָ֖ה
      1. הוֹדַוְיָ֖הho.dav.YahHodaviahH1938I
    9. בֶּן־
      1. בֶּןben-[the] son ofH1121A
    10. הַסְּנֻאָֽה׃
      1. הַha.<the>H9009
      2. סְּנֻאָֽהse.nu.'AhSenaahH5570G
  8. 8and Ibneiah the son of Jeroham, and Elah the son of Uzzi, the son of Michri, and Meshullam the son of Shephatiah, the son of Reuel, the son of Ibnijah;
    1. וְיִבְנְיָה֙
      1. וְve.andH9002
      2. יִבְנְיָה֙yiv.ne.YahIbneiahH2997
    2. בֶּן־
      1. בֶּןben-[the] son ofH1121A
    3. יְרֹחָ֔ם
      1. יְרֹחָ֔םye.ro.ChamJerohamH3395I
    4. וְאֵלָ֥ה
      1. וְve.andH9002
      2. אֵלָ֥ה'e.LahElahH0425K
    5. בֶן־
      1. בֶןven-[the] son ofH1121A
    6. עֻזִּ֖י
      1. עֻזִּ֖י'u.ZiUzziH5813J
    7. בֶּן־
      1. בֶּןben-[the] son ofH1121A
    8. מִכְרִ֑י
      1. מִכְרִ֑יmikh.RiMikriH4381
    9. וּמְשֻׁלָּם֙
      1. וּu.andH9002
      2. מְשֻׁלָּם֙me.shu.LamMeshullamH4918L
    10. בֶּן־
      1. בֶּןben-[the] son ofH1121A
    11. שְׁפַטְיָ֔ה
      1. שְׁפַטְיָ֔הshe.fat.YahShephatiahH8203H
    12. בֶּן־
      1. בֶּןben-[the] son ofH1121A
    13. רְעוּאֵ֖ל
      1. רְעוּאֵ֖לre.'u.'ElReuelH7467H
    14. בֶּן־
      1. בֶּןben-[the] son ofH1121A
    15. יִבְנִיָּֽה׃
      1. יִבְנִיָּֽהyiv.ni.YahIbnijahH2998
  9. 9and their brethren, according to their generations, nine hundred and fifty and six. All these men were heads of fathers' [ergänzt: houses] by their fathers' houses.
    1. וַאֲחֵיהֶם֙
      1. וַva.andH9002
      2. אֲחֵי'a.chei.relativesH0251H
      3. הֶם֙HemtheirH9028
    2. לְתֹ֣לְדוֹתָ֔ם
      1. לְle.toH9005
      2. תֹ֣לְדוֹתָ֔To.le.do.TagenerationsH8435
      3. םmtheirH9028
    3. תְּשַׁ֥ע
      1. תְּשַׁ֥עte.Sha'nineH8672
    4. מֵא֖וֹת
      1. מֵא֖וֹתme.'othundred<s>H3967
    5. וַחֲמִשִּׁ֣ים
      1. וַva.andH9002
      2. חֲמִשִּׁ֣יםcha.mi.ShimfiftyH2572
    6. וְשִׁשָּׁ֑ה
      1. וְve.andH9002
      2. שִׁשָּׁ֑הshi.ShahsixH8337
    7. כָּל־
      1. כָּלkol-allH3605
    8. אֵ֣לֶּה
      1. אֵ֣לֶּה'E.lehtheseH0428
    9. אֲנָשִׁ֔ים
      1. אֲנָשִׁ֔ים'a.na.ShimmenH0582
    10. רָאשֵׁ֥י
      1. רָאשֵׁ֥יra.Shei[were] chiefs ofH7218H
    11. אָב֖וֹת
      1. אָב֖וֹת'a.VotfathersH0001G
    12. לְבֵ֥ית
      1. לְle.toH9005
      2. בֵ֥יתVeit[the] house ofH1004M
    13. אֲבֹתֵיהֶֽם׃
      1. אֲבֹתֵי'a.vo.tei.ancestorsH0001G
      2. הֶֽםHemtheirH9028
  10. 10And of the priests: Jedaiah, and Jehoiarib, Jachin,
    1. וּמִן־
      1. וּu.andH9002
      2. מִןmin-ofH4480A
    2. הַֽכֹּהֲנִ֑ים
      1. הַֽha.theH9009
      2. כֹּהֲנִ֑יםko.ha.NimpriestsH3548
    3. יְדַֽעְיָ֥ה
      1. יְדַֽעְיָ֥הye.da'.YahJedaiahH3048G
    4. וִיהוֹיָרִ֖יב
      1. וִvi.andH9002
      2. יהוֹיָרִ֖יבho.ya.RivJehoiaribH3080H
    5. וְיָכִֽין׃
      1. וְve.andH9002
      2. יָכִֽיןya.KhinJakinH3199I
  11. 11and Azariah the son of Hilkiah, the son of Meshullam, the son of Zadok, the son of Meraioth, the son of Ahitub, the ruler of the house of God;
    1. וַעֲזַרְיָ֨ה
      1. וַva.andH9002
      2. עֲזַרְיָ֨ה'a.zar.YahAzariahH5838L
    2. בֶן־
      1. בֶןven-[the] son ofH1121A
    3. חִלְקִיָּ֜ה
      1. חִלְקִיָּ֜הchil.ki.YahHilkiahH2518H
    4. בֶּן־
      1. בֶּןben-[the] son ofH1121A
    5. מְשֻׁלָּ֣ם
      1. מְשֻׁלָּ֣םme.shu.LamMeshullamH4918y
    6. בֶּן־
      1. בֶּןben-[the] son ofH1121A
    7. צָד֗וֹק
      1. צָד֗וֹקtza.DokZadokH6659I
    8. בֶּן־
      1. בֶּןben-[the] son ofH1121A
    9. מְרָיוֹת֙
      1. מְרָיוֹת֙me.ra.yOtMeraiothH4812G
    10. בֶּן־
      1. בֶּןben-[the] son ofH1121A
    11. אֲחִיט֔וּב
      1. אֲחִיט֔וּב'a.chi.TuvAhitubH0285J
    12. נְגִ֖יד
      1. נְגִ֖ידne.Gid[the] leader ofH5057
    13. בֵּ֥ית
      1. בֵּ֥יתbeit[the] house ofH1004Q
    14. הָאֱלֹהִֽים׃
      1. הָha.<the>H9009
      2. אֱלֹהִֽים'E.lo.HimGodH0430G
  12. 12and Adaiah the son of Jeroham, the son of Pashhur, the son of Malchijah, and Maasai the son of Adiel, the son of Jahzerah, the son of Meshullam, the son of Meshillemith, the son of Immer;
    1. וַעֲדָיָה֙
      1. וַva.andH9002
      2. עֲדָיָה֙'a.da.YahAdaiahH5718I
    2. בֶּן־
      1. בֶּןben-[the] son ofH1121A
    3. יְרֹחָ֔ם
      1. יְרֹחָ֔םye.ro.ChamJerohamH3395J
    4. בֶּן־
      1. בֶּןben-[the] son ofH1121A
    5. פַּשְׁח֖וּר
      1. פַּשְׁח֖וּרpash.ChurPashhurH6583G
    6. בֶּן־
      1. בֶּןben-[the] son ofH1121A
    7. מַלְכִּיָּ֑ה
      1. מַלְכִּיָּ֑הmal.ki.YahMalkijahH4441H
    8. וּמַעְשַׂ֨י
      1. וּu.andH9002
      2. מַעְשַׂ֨יma'.SaiMaasaiH4640
    9. בֶּן־
      1. בֶּןben-[the] son ofH1121A
    10. עֲדִיאֵ֧ל
      1. עֲדִיאֵ֧ל'a.di.'ElAdielH5717H
    11. בֶּן־
      1. בֶּןben-[the] son ofH1121A
    12. יַחְזֵ֛רָה
      1. יַחְזֵ֛רָהyach.Ze.rahJahzerahH3170
    13. בֶּן־
      1. בֶּןben-[the] son ofH1121A
    14. מְשֻׁלָּ֥ם
      1. מְשֻׁלָּ֥םme.shu.LamMeshullamH4918M
    15. בֶּן־
      1. בֶּןben-[the] son ofH1121A
    16. מְשִׁלֵּמִ֖ית
      1. מְשִׁלֵּמִ֖יתme.shi.le.MitMeshillemithH4921
    17. בֶּן־
      1. בֶּןben-[the] son ofH1121A
    18. אִמֵּֽר׃
      1. אִמֵּֽר'i.MerImmerH0564G
  13. 13and their brethren, heads of their fathers' houses, a thousand and seven hundred and threescore; very able men for the work of the service of the house of God.
    1. וַאֲחֵיהֶ֗ם
      1. וַva.andH9002
      2. אֲחֵי'a.chei.relativesH0251H
      3. הֶ֗םHemtheirH9028
    2. רָאשִׁים֙
      1. רָאשִׁים֙ra.ShimchiefsH7218H
    3. לְבֵ֣ית
      1. לְle.ofH9005
      2. בֵ֣יתVeit[the] house ofH1004M
    4. אֲבוֹתָ֔ם
      1. אֲבוֹתָ֔'a.vo.TaancestorsH0001G
      2. םmtheirH9028
    5. אֶ֕לֶף
      1. אֶ֕לֶף'E.lefone thousandH0505G
    6. וּשְׁבַ֥ע
      1. וּu.andH9002
      2. שְׁבַ֥עshe.Va'sevenH7651
    7. מֵא֖וֹת
      1. מֵא֖וֹתme.'othundred<s>H3967
    8. וְשִׁשִּׁ֑ים
      1. וְve.andH9002
      2. שִׁשִּׁ֑יםshi.ShimsixtyH8346
    9. גִּבּ֣וֹרֵי
      1. גִּבּ֣וֹרֵיgi.Bo.rei<the> mighty [men] ofH1368
    10. חֵ֔יל
      1. חֵ֔ילCheil<the> ability ofH2428G
    11. מְלֶ֖אכֶת
      1. מְלֶ֖אכֶתme.Le.khet[the] work ofH4399
    12. עֲבוֹדַ֥ת
      1. עֲבוֹדַ֥תa.vo.Dat[the] service ofH5656H
    13. בֵּית־
      1. בֵּיתbeit-[the] house ofH1004Q
    14. הָאֱלֹהִֽים׃
      1. הָha.<the>H9009
      2. אֱלֹהִֽים'E.lo.HimGodH0430G
  14. 14And of the Levites: Shemaiah the son of Hasshub, the son of Azrikam, the son of Hashabiah, of the sons of Merari;
    1. וּמִֽן־
      1. וּu.andH9002
      2. מִֽןmin-ofH4480A
    2. הַלְוִיִּ֑ם
      1. הַhatheH9009
      2. לְוִיִּ֑םl.vi.YimLevitesH3881
    3. שְׁמַֽעְיָ֧ה
      1. שְׁמַֽעְיָ֧הshe.ma'.YahShemaiahH8098E
    4. בֶן־
      1. בֶןven-[the] son ofH1121A
    5. חַשּׁ֛וּב
      1. חַשּׁ֛וּבcha.ShuvHasshubH2815G
    6. בֶּן־
      1. בֶּןben-[the] son ofH1121A
    7. עַזְרִיקָ֥ם
      1. עַזְרִיקָ֥ם'az.ri.KamAzrikamH5840I
    8. בֶּן־
      1. בֶּןben-[the] son ofH1121A
    9. חֲשַׁבְיָ֖ה
      1. חֲשַׁבְיָ֖הcha.shav.YahHashabiahH2811H
    10. מִן־
      1. מִןmin-ofH4480A
    11. בְּנֵ֥י
      1. בְּנֵ֥יbe.Nei[the] descendants ofH1121A
    12. מְרָרִֽי׃
      1. מְרָרִֽיme.ra.RiMerariH4847
  15. 15and Bakbakkar, Heresh, and Galal, and Mattaniah the son of Mica, the son of Zichri, the son of Asaph,
    1. וּבַקְבַּקַּ֥ר
      1. וּu.andH9002
      2. בַקְבַּקַּ֥רvak.ba.KarBakbakkarH1230
    2. חֶ֖רֶשׁ
      1. חֶ֖רֶשׁChe.reshHereshH2792
    3. וְגָלָ֑ל
      1. וְve.andH9002
      2. גָלָ֑לga.LalGalalH1559G
    4. וּמַתַּנְיָה֙
      1. וּu.andH9002
      2. מַתַּנְיָה֙ma.tan.YahMattaniahH4983G
    5. בֶּן־
      1. בֶּןben-[the] son ofH1121A
    6. מִיכָ֔א
      1. מִיכָ֔אmi.Kha'MicaH4316G
    7. בֶּן־
      1. בֶּןben-[the] son ofH1121A
    8. זִכְרִ֖י
      1. זִכְרִ֖יzikh.RiZikriH2147K
    9. בֶּן־
      1. בֶּןben-[the] son ofH1121A
    10. אָסָֽף׃
      1. אָסָֽף'a.SafAsaphH0623I
  16. 16and Obadiah the son of Shemaiah, the son of Galal, the son of Jeduthun, and Berechiah the son of Asa, the son of Elkanah, that dwelt in the villages of the Netophathites.
    1. וְעֹבַדְיָה֙
      1. וְve.andH9002
      2. עֹבַדְיָה֙'oad.YahObadiahH5662K
    2. בֶּֽן־
      1. בֶּֽןben-[the] son ofH1121A
    3. שְׁמַֽעְיָ֔ה
      1. שְׁמַֽעְיָ֔הshe.ma'.YahShemaiahH8098F
    4. בֶּן־
      1. בֶּןben-[the] son ofH1121A
    5. גָּלָ֖ל
      1. גָּלָ֖לga.LalGalalH1559H
    6. בֶּן־
      1. בֶּןben-[the] son ofH1121A
    7. יְדוּת֑וּן
      1. יְדוּת֑וּןye.du.TunJeduthunH3038H
    8. וּבֶרֶכְיָ֤ה
      1. וּu.andH9002
      2. בֶרֶכְיָ֤הve.rekh.YahBerekiahH1296I
    9. בֶן־
      1. בֶןven-[the] son ofH1121A
    10. אָסָא֙
      1. אָסָא֙'a.Sa'AsaH0609H
    11. בֶּן־
      1. בֶּןben-[the] son ofH1121A
    12. אֶלְקָנָ֔ה
      1. אֶלְקָנָ֔ה'el.ka.NahElkanahH0511K
    13. הַיּוֹשֵׁ֖ב
      1. הַhai.whoH9009
      2. יּוֹשֵׁ֖בyo.ShevdweltH3427
    14. בְּחַצְרֵ֥י
      1. בְּbe.inH9003
      2. חַצְרֵ֥יchatz.Rei[the] villages ofH2691B
    15. נְטוֹפָתִֽי׃
      1. נְטוֹפָתִֽיne.to.fa.Ti[the] Netophathite[s]H5200
  17. 17And the porters: Shallum, and Akkub, and Talmon, and Ahiman, and their brethren (Shallum was the chief),
    1. וְהַשֹּׁעֲרִים֙
      1. וְve.andH9002
      2. הַha.theH9009
      3. שֹּׁעֲרִים֙sho.'a.RimgatekeepersH7778
    2. שַׁלּ֣וּם
      1. שַׁלּ֣וּםsha.LumShallumH7967M
    3. וְעַקּ֔וּב
      1. וְve.andH9002
      2. עַקּ֔וּב'a.KuvAkkubH6126H
    4. וְטַלְמֹ֖ן
      1. וְve.andH9002
      2. טַלְמֹ֖ןtal.MonTalmonH2929
    5. וַאֲחִימָ֑ן
      1. וַva.andH9002
      2. אֲחִימָ֑ן'a.chi.ManAhimanH0289H
    6. וַאֲחִיהֶ֥ם
      1. וַva.andH9002
      2. אֲחִי'a.chi.brotherH0251H
      3. הֶ֥םHemtheirH9028
    7. שַׁלּ֖וּם
      1. שַׁלּ֖וּםsha.LumShallumH7967M
    8. הָרֹֽאשׁ׃
      1. הָha.[was] theH9009
      2. רֹֽאשׁRoshchiefH7218H
  18. 18who hitherto [ergänzt: waited] in the king's gate eastward: they were the porters for the camp of the children of Levi.
    1. וְֽעַד־
      1. וְֽve.andH9002
      2. עַד'ad-untilH5704
    2. הֵ֔נָּה
      1. הֵ֔נָּהHe.nahnowH2008
    3. בְּשַׁ֥עַר
      1. בְּbe.inH9003
      2. שַׁ֥עַרSha.'ar[the] gate ofH8179G
    4. הַמֶּ֖לֶךְ
      1. הַha.theH9009
      2. מֶּ֖לֶךְMe.lekhkingH4428G
    5. מִזְרָ֑חָה
      1. מִזְרָ֑חָmiz.Ra.chaeastH4217H
      2. הh-wardH9011
    6. הֵ֚מָּה
      1. הֵ֚מָּהHe.mahtheyH1992
    7. הַשֹּׁ֣עֲרִ֔ים
      1. הַha.[were] theH9009
      2. שֹּׁ֣עֲרִ֔יםSho.'a.RimgatekeepersH7778
    8. לְמַחֲנ֖וֹת
      1. לְle.ofH9005
      2. מַחֲנ֖וֹתma.cha.Not[the] camps ofH4264
    9. בְּנֵ֥י
      1. בְּנֵ֥יbe.Nei[the] descendants ofH1121G
    10. לֵוִֽי׃
      1. לֵוִֽיle.ViLeviH3878
  19. 19And Shallum the son of Kore, the son of Ebiasaph, the son of Korah, and his brethren, of his father's house, the Korahites, were over the work of the service, keepers of the thresholds of the tent: and their fathers had been over the camp of Jehovah, keepers of the entry.
    1. וְשַׁלּ֣וּם
      1. וְve.andH9002
      2. שַׁלּ֣וּםsha.LumShallumH7967M
    2. בֶּן־
      1. בֶּןben-[the] son ofH1121A
    3. ק֠וֹרֵא
      1. ק֠וֹרֵאKo.re'KoreH6981G
    4. בֶּן־
      1. בֶּןben-[the] son ofH1121A
    5. אֶבְיָסָ֨ף
      1. אֶבְיָסָ֨ף'ev.ya.SafEbiasaphH0043
    6. בֶּן־
      1. בֶּןben-[the] son ofH1121A
    7. קֹ֜רַח
      1. קֹ֜רַחKo.rachKorahH7141I
    8. וְֽאֶחָ֧יו
      1. וְֽve.andH9002
      2. אֶחָ֧י'e.CharelativesH0251H
      3. וvhisH9023
    9. לְבֵית־
      1. לְle.ofH9005
      2. בֵיתveit-[the] house ofH1004M
    10. אָבִ֣יו
      1. אָבִ֣י'a.VifatherH0001G
      2. וvhisH9023
    11. הַקָּרְחִ֗ים
      1. הַha.theH9009
      2. קָּרְחִ֗יםka.re.ChimKorahitesH7145
    12. עַ֚ל
      1. עַ֚ל'al[were] overH5921A
    13. מְלֶ֣אכֶת
      1. מְלֶ֣אכֶתme.Le.khet[the] work ofH4399
    14. הָעֲבוֹדָ֔ה
      1. הָha.theH9009
      2. עֲבוֹדָ֔ה'a.vo.DahserviceH5656H
    15. שֹׁמְרֵ֥י
      1. שֹׁמְרֵ֥יsho.me.Rei[the] keepers ofH8104H
    16. הַסִּפִּ֖ים
      1. הַha.theH9009
      2. סִּפִּ֖יםsi.PimthresholdsH5592B
    17. לָאֹ֑הֶל
      1. לָla.of theH9005
      2. אֹ֑הֶל'O.heltentH0168G
    18. וַאֲבֹֽתֵיהֶם֙
      1. וַva.andH9002
      2. אֲבֹֽתֵי'a.vo.tei.ancestorsH0001G
      3. הֶם֙HemtheirH9028
    19. עַל־
      1. עַל'al-[had been] overH5921A
    20. מַחֲנֵ֣ה
      1. מַחֲנֵ֣הma.cha.Neh[the] camp ofH4264
    21. יְהוָ֔ה
      1. יְהוָ֔הYah.wehYahwehH3068G
    22. שֹׁמְרֵ֖י
      1. שֹׁמְרֵ֖יsho.me.Rei[the] keepers ofH8104H
    23. הַמָּבֽוֹא׃
      1. הַha.theH9009
      2. מָּבֽוֹאma.Vo'entranceH3996
  20. 20And Phinehas the son of Eleazar was ruler over them in time past, [ergänzt: and] Jehovah was with him.
    1. וּפִֽינְחָ֣ס
      1. וּu.andH9002
      2. פִֽינְחָ֣סfin.ChasPhinehasH6372G
    2. בֶּן־
      1. בֶּןben-[the] son ofH1121A
    3. אֶלְעָזָ֗ר
      1. אֶלְעָזָ֗ר'el.'a.ZarEleazarH0499G
    4. נָגִ֨יד
      1. נָגִ֨ידna.Gida leaderH5057
    5. הָיָ֧ה
      1. הָיָ֧הha.Yahhe had beenH1961
    6. עֲלֵיהֶ֛ם
      1. עֲלֵי'a.lei.overH5921A
      2. הֶ֛םHemthemH9038
    7. לְפָנִ֖ים
      1. לְle.<to>H9005
      2. פָנִ֖יםfa.NimbeforeH6440G
    8. יְהוָ֥ה׀
      1. יְהוָ֥הYah.wehYahwehH3068G
    9. עִמּֽוֹ׃
      1. עִמּֽi.M[was] withH5973A
      2. וֹohimH9033
  21. 21Zechariah the son of Meshelemiah was porter of the door of the tent of meeting.
    1. זְכַרְיָה֙
      1. זְכַרְיָה֙ze.khar.YahZechariahH2148A
    2. בֶּ֣ן
      1. בֶּ֣ןben[the] son ofH1121A
    3. מְשֶֽׁלֶמְיָ֔ה
      1. מְשֶֽׁלֶמְיָ֔הme.she.lem.YahMeshelemiahH4920
    4. שֹׁעֵ֥ר
      1. שֹׁעֵ֥רsho.'Er[was] a gatekeeper ofH7778
    5. פֶּ֖תַח
      1. פֶּ֖תַחPe.tach[the] entranceH6607
    6. לְאֹ֥הֶל
      1. לְle.ofH9005
      2. אֹ֥הֶל'O.hel[the] tent ofH0168G
    7. מוֹעֵֽד׃
      1. מוֹעֵֽדmo.'EdmeetingH4150I
  22. 22All these that were chosen to be porters in the thresholds were two hundred and twelve. These were reckoned by genealogy in their villages, whom David and Samuel the seer did ordain in their office of trust.
    1. כֻּלָּ֤ם
      1. כֻּלָּ֤ku.Laall ofH3605
      2. םmthemH9028
    2. הַבְּרוּרִים֙
      1. הַha.whoH9009
      2. בְּרוּרִים֙be.ru.Rimhad been chosenH1305
    3. לְשֹׁעֲרִ֣ים
      1. לְle.toH9005
      2. שֹׁעֲרִ֣יםsho.'a.RimgatekeepersH7778
    4. בַּסִּפִּ֔ים
      1. בַּba.at theH9003
      2. סִּפִּ֔יםsi.PimthresholdsH5592B
    5. מָאתַ֖יִם
      1. מָאתַ֖יִםma.Ta.yim[were] two hundredH3967
    6. וּשְׁנֵ֣ים
      1. וּu.andH9002
      2. שְׁנֵ֣יםshe.Neimtwo [plus]H8147
    7. עָשָׂ֑ר
      1. עָשָׂ֑ר'a.SartenH6240
    8. הֵ֤מָּה
      1. הֵ֤מָּהHe.mahtheyH1992
    9. בְחַצְרֵיהֶם֙
      1. בְve.[was] inH9003
      2. חַצְרֵיchatz.rei.villagesH2691B
      3. הֶם֙HemtheirH9028
    10. הִתְיַחְשָׂ֔ם
      1. הִתְיַחְשָׂ֔hit.yach.Sarecording genealogyH3187
      2. םmtheyH9048
    11. הֵ֣מָּה
      1. הֵ֣מָּהHe.mahthemH1992
    12. יִסַּ֥ד
      1. יִסַּ֥דyi.Sadhe had appointedH3245
    13. דָּוִ֛יד
      1. דָּוִ֛ידda.VidDavidH1732
    14. וּשְׁמוּאֵ֥ל
      1. וּu.andH9002
      2. שְׁמוּאֵ֥לshe.mu.'ElSamuelH8050G
    15. הָרֹאֶ֖ה
      1. הָha.theH9009
      2. רֹאֶ֖הro.'EhseerH7203A
    16. בֶּאֱמוּנָתָֽם׃
      1. בֶּbe.inH9003
      2. אֱמוּנָתָֽ'e.mu.na.TafaithfulnessH0530
      3. םmtheirH9028
  23. 23So they and their children had the oversight of the gates of the house of Jehovah, even the house of the tent, by wards.
    1. וְהֵ֨ם
      1. וְve.andH9002
      2. הֵ֨םHemtheyH1992
    2. וּבְנֵיהֶ֜ם
      1. וּu.andH9002
      2. בְנֵיve.nei.descendantsH1121G
      3. הֶ֜םHemtheirH9028
    3. עַל־
      1. עַל'al-[were] overH5921A
    4. הַשְּׁעָרִ֧ים
      1. הַha.theH9009
      2. שְּׁעָרִ֧יםshe.'a.RimgatesH8179G
    5. לְבֵית־
      1. לְle.ofH9005
      2. בֵיתveit-[the] house ofH1004Q
    6. יְהוָ֛ה
      1. יְהוָ֛הYah.wehYahwehH3068G
    7. לְבֵ֥ית־
      1. לְle.ofH9005
      2. בֵ֥יתVeit-[the] house ofH1004B
    8. הָאֹ֖הֶל
      1. הָha.theH9009
      2. אֹ֖הֶל'O.heltentH0168G
    9. לְמִשְׁמָרֽוֹת׃
      1. לְle.toH9005
      2. מִשְׁמָרֽוֹתmish.ma.RotguardsH4931
  24. 24On the four sides were the porters, toward the east, west, north, and south.
    1. לְאַרְבַּ֣ע
      1. לְle.toH9005
      2. אַרְבַּ֣ע'ar.Ba'fourH0702
    2. רוּח֔וֹת
      1. רוּח֔וֹתru.ChotsidesH7307I
    3. יִהְי֖וּ
      1. יִהְי֖וּyih.Yuthey wereH1961
    4. הַשֹּׁעֲרִ֑ים
      1. הַha.theH9009
      2. שֹּׁעֲרִ֑יםsho.'a.RimgatekeepersH7778
    5. מִזְרָ֥ח
      1. מִזְרָ֥חmiz.Rach[the] eastH4217H
    6. יָ֖מָּה
      1. יָ֖מָּYa.mawestH3220H
      2. הh-wardH9011
    7. צָפ֥וֹנָה
      1. צָפ֥וֹנָtza.Fo.nanorthH6828G
      2. הh-wardH9011
    8. וָנֶֽגְבָּה׃
      1. וָva.andH9002
      2. נֶֽגְבָּNeg.basouthH5045H
      3. הh-wardH9011
  25. 25And their brethren, in their villages, were to come in every seven days from time to time to be with them:
    1. וַאֲחֵיהֶ֨ם
      1. וַva.andH9002
      2. אֲחֵי'a.chei.relativesH0251H
      3. הֶ֨םHemtheirH9028
    2. בְּחַצְרֵיהֶ֜ם
      1. בְּbe.inH9003
      2. חַצְרֵיchatz.rei.villagesH2691B
      3. הֶ֜םHemtheirH9028
    3. לָב֨וֹא
      1. לָla.[were] toH9005
      2. ב֨וֹאVo'comeH0935G
    4. לְשִׁבְעַ֧ת
      1. לְle.forH9005
      2. שִׁבְעַ֧תshiv.'At[the] sevenH7651
    5. הַיָּמִ֛ים
      1. הַhai.theH9009
      2. יָּמִ֛יםya.MimdaysH3117G
    6. מֵעֵ֥ת
      1. מֵme.fromH9006
      2. עֵ֥ת'EttimeH6256
    7. אֶל־
      1. אֶל'el-toH0413
    8. עֵ֖ת
      1. עֵ֖ת'ettimeH6256
    9. עִם־
      1. עִם'im-withH5973A
    10. אֵֽלֶּה׃
      1. אֵֽלֶּה'E.lehtheseH0428
  26. 26for the four chief porters, who were Levites, were in an office of trust, and were over the chambers and over the treasuries in the house of God.
    1. כִּ֣י
      1. כִּ֣יkiforH3588A
    2. בֶאֱמוּנָ֞ה
      1. בֶve.inH9003
      2. אֱמוּנָ֞ה'e.mu.NahfaithfulnessH0530
    3. הֵ֗מָּה
      1. הֵ֗מָּהHe.mahtheyH1992
    4. אַרְבַּ֙עַת֙
      1. אַרְבַּ֙עַת֙'ar.Ba.'at[the] fourH0702
    5. גִּבֹּרֵ֣י
      1. גִּבֹּרֵ֣יgi.bo.Rei[the] mighty [ones] ofH1368
    6. הַשֹּׁעֲרִ֔ים
      1. הַha.theH9009
      2. שֹּׁעֲרִ֔יםsho.'a.RimgatekeepersH7778
    7. הֵ֖ם
      1. הֵ֖םhemtheyH1992
    8. הַלְוִיִּ֑ם
      1. הַha[were] theH9009
      2. לְוִיִּ֑םl.vi.YimLevitesH3881
    9. וְהָיוּ֙
      1. וְve.andH9001
      2. הָיוּ֙ha.Yuthey wereH1961
    10. עַל־
      1. עַל'al-overH5921A
    11. הַלְּשָׁכ֔וֹת
      1. הַha.theH9009
      2. לְּשָׁכ֔וֹתle.sha.Khotstore-roomsH3957
    12. וְעַ֥ל
      1. וְve.andH9002
      2. עַ֥ל'AloverH5921A
    13. הָאֹצְר֖וֹת
      1. הָha.theH9009
      2. אֹצְר֖וֹת'o.tze.Rottreasuries ofH0214
    14. בֵּ֥ית
      1. בֵּ֥יתbeit[the] house ofH1004Q
    15. הָאֱלֹהִֽים׃
      1. הָha.<the>H9009
      2. אֱלֹהִֽים'E.lo.HimGodH0430G
  27. 27And they lodged round about the house of God, because the charge [ergänzt: thereof] was upon them; and to them pertained the opening thereof morning by morning.
    1. וּסְבִיב֥וֹת
      1. וּu.andH9002
      2. סְבִיב֥וֹתse.vi.VotaroundH5439G
    2. בֵּית־
      1. בֵּיתbeit-[the] house ofH1004Q
    3. הָאֱלֹהִ֖ים
      1. הָha.<the>H9009
      2. אֱלֹהִ֖ים'E.lo.HimGodH0430G
    4. יָלִ֑ינוּ
      1. יָלִ֑ינוּya.Li.nuthey spent [the] nightH3885A
    5. כִּֽי־
      1. כִּֽיki-forH3588A
    6. עֲלֵיהֶ֣ם
      1. עֲלֵי'a.lei.[was] onH5921A
      2. הֶ֣םHemthemH9038
    7. מִשְׁמֶ֔רֶת
      1. מִשְׁמֶ֔רֶתmish.Me.reta dutyH4931
    8. וְהֵ֥ם
      1. וְve.andH9002
      2. הֵ֥םHemtheyH1992
    9. עַל־
      1. עַל'al-[were] overH5921A
    10. הַמַּפְתֵּ֖חַ
      1. הַha.theH9009
      2. מַּפְתֵּ֖חַmaf.Te.achkeyH4668
    11. וְלַבֹּ֥קֶר
      1. וְve.andH9002
      2. לַla.to theH9005
      3. בֹּ֥קֶרBo.kermorningH1242
    12. לַבֹּֽקֶר׃
      1. לַla.to theH9005
      2. בֹּֽקֶרBo.kermorningH1242
  28. 28And certain of them had charge of the vessels of service; for by count were these brought in and by count were these taken out.
    1. וּמֵהֶ֖ם
      1. וּu.andH9002
      2. מֵme.some ofH9006
      3. הֶ֖םHemthemH9038
    2. עַל־
      1. עַל'al-[were] overH5921A
    3. כְּלֵ֣י
      1. כְּלֵ֣יke.Lei[the] articles ofH3627
    4. הָעֲבוֹדָ֑ה
      1. הָha.theH9009
      2. עֲבוֹדָ֑ה'a.vo.DahserviceH5656H
    5. כִּֽי־
      1. כִּֽיki-forH3588A
    6. בְמִסְפָּ֣ר
      1. בְve.byH9003
      2. מִסְפָּ֣רmis.ParnumberH4557
    7. יְבִיא֔וּם
      1. יְבִיא֔וּye.vi.'Uthey broughtH0935P
      2. םmthemH9038
    8. וּבְמִסְפָּ֖ר
      1. וּu.andH9002
      2. בְve.byH9003
      3. מִסְפָּ֖רmis.ParnumberH4557
    9. יוֹצִיאֽוּם׃
      1. יוֹצִיאֽוּyo.tzi.'Uthey took outH3318H
      2. םmthemH9038
  29. 29Some of them also were appointed over the furniture, and over all the vessels of the sanctuary, and over the fine flour, and the wine, and the oil, and the frankincense, and the spices.
    1. וּמֵהֶ֗ם
      1. וּu.andH9002
      2. מֵme.some ofH9006
      3. הֶ֗םHemthemH9038
    2. מְמֻנִּים֙
      1. מְמֻנִּים֙me.mu.Nim[were] appointedH4487
    3. עַל־
      1. עַל'al-overH5921A
    4. הַכֵּלִ֔ים
      1. הַha.theH9009
      2. כֵּלִ֔יםke.LimarticlesH3627
    5. וְעַ֖ל
      1. וְve.andH9002
      2. עַ֖ל'AloverH5921A
    6. כָּל־
      1. כָּלkol-allH3605
    7. כְּלֵ֣י
      1. כְּלֵ֣יke.Lei[the] articles ofH3627
    8. הַקֹּ֑דֶשׁ
      1. הַha.theH9009
      2. קֹּ֑דֶשׁKo.deshholy placeH6944G
    9. וְעַל־
      1. וְve.andH9002
      2. עַל'al-overH5921A
    10. הַסֹּ֙לֶת֙
      1. הַha.theH9009
      2. סֹּ֙לֶת֙So.letfine flourH5560
    11. וְהַיַּ֣יִן
      1. וְve.andH9002
      2. הַhai.theH9009
      3. יַּ֣יִןYa.yinwineH3196
    12. וְהַשֶּׁ֔מֶן
      1. וְve.andH9002
      2. הַha.theH9009
      3. שֶּׁ֔מֶןShe.menoilH8081
    13. וְהַלְּבוֹנָ֖ה
      1. וְve.andH9002
      2. הַha.theH9009
      3. לְּבוֹנָ֖הle.vo.NahfrankincenseH3828
    14. וְהַבְּשָׂמִֽים׃
      1. וְve.andH9002
      2. הַha.theH9009
      3. בְּשָׂמִֽיםbe.sa.MimspicesH1314
  30. 30And some of the sons of the priests prepared the confection of the spices.
    1. וּמִן־
      1. וּu.andH9002
      2. מִןmin-some ofH4480A
    2. בְּנֵי֙
      1. בְּנֵי֙be.Nei[the] sons ofH1121A
    3. הַכֹּ֣הֲנִ֔ים
      1. הַha.theH9009
      2. כֹּ֣הֲנִ֔יםKo.ha.NimpriestsH3548
    4. רֹקְחֵ֥י
      1. רֹקְחֵ֥יro.ke.Chei[were those who] mixedH7543
    5. הַמִּרְקַ֖חַת
      1. הַha.<of> theH9009
      2. מִּרְקַ֖חַתmir.Ka.chatmixtureH4842
    6. לַבְּשָׂמִֽים׃
      1. לַla.of theH9005
      2. בְּשָׂמִֽיםbe.sa.MimspicesH1314
  31. 31And Mattithiah, one of the Levites, who was the first-born of Shallum the Korahite, had the office of trust over the things that were baked in pans.
    1. וּמַתִּתְיָה֙
      1. וּu.andH9002
      2. מַתִּתְיָה֙ma.tit.YahMattithiahH4993G
    2. מִן־
      1. מִןmin-one ofH4480A
    3. הַלְוִיִּ֔ם
      1. הַhatheH9009
      2. לְוִיִּ֔םl.vi.YimLevitesH3881
    4. ה֥וּא
      1. ה֥וּאhu'heH1931
    5. הַבְּכ֖וֹר
      1. הַha.[was] theH9009
      2. בְּכ֖וֹרbe.KhorfirstbornH1060
    6. לְשַׁלֻּ֣ם
      1. לְle.ofH9005
      2. שַׁלֻּ֣םsha.LumShallumH7967M
    7. הַקָּרְחִ֑י
      1. הַha.theH9009
      2. קָּרְחִ֑יka.re.ChiKorahiteH7145
    8. בֶּאֱמוּנָ֕ה
      1. בֶּbe.inH9003
      2. אֱמוּנָ֕ה'e.mu.NahfaithfulnessH0530
    9. עַ֖ל
      1. עַ֖ל'al[was] overH5921A
    10. מַעֲשֵׂ֥ה
      1. מַעֲשֵׂ֥הma.'a.Seh[the] work ofH4639G
    11. הַחֲבִתִּֽים׃
      1. הַha.theH9009
      2. חֲבִתִּֽיםcha.vi.Timflat cakesH2281
  32. 32And some of their brethren, of the sons of the Kohathites, were over the showbread, to prepare it every sabbath.
    1. וּמִן־
      1. וּu.andH9002
      2. מִןmin-some ofH4480A
    2. בְּנֵ֧י
      1. בְּנֵ֧יbe.Nei[the] sons ofH1121G
    3. הַקְּהָתִ֛י
      1. הַha.theH9009
      2. קְּהָתִ֛יke.ha.TiKohathite[s]H6956
    4. מִן־
      1. מִןmin-some ofH4480A
    5. אֲחֵיהֶ֖ם
      1. אֲחֵי'a.chei.relativesH0251H
      2. הֶ֖םHemtheirH9028
    6. עַל־
      1. עַל'al-[were] overH5921A
    7. לֶ֣חֶם
      1. לֶ֣חֶםLe.chem[the] bread ofH3899H
    8. הַֽמַּעֲרָ֑כֶת
      1. הַֽha.theH9009
      2. מַּעֲרָ֑כֶתma.'a.Ra.khetrowH4635
    9. לְהָכִ֖ין
      1. לְle.toH9005
      2. הָכִ֖יןha.Khinprepare [it]H3559A
    10. שַׁבַּ֥ת
      1. שַׁבַּ֥תsha.BatsabbathH7676
    11. שַׁבָּֽת׃
      1. שַׁבָּֽתsha.BatsabbathH7676
  33. 33And these are the singers, heads of fathers' [ergänzt: houses] of the Levites, [ergänzt: who dwelt] in the chambers [ergänzt: and were] free [ergänzt: from other service]; for they were employed in their work day and night.
    1. וְאֵ֣לֶּה
      1. וְve.andH9002
      2. אֵ֣לֶּה'E.lehtheseH0428
    2. הַ֠מְשֹׁרְרִים
      1. הַ֠HatheH9009
      2. מְשֹׁרְרִיםm.sho.re.rimsingersH7891
    3. רָאשֵׁ֨י
      1. רָאשֵׁ֨יra.Shei[the] chiefs ofH7218H
    4. אָב֧וֹת
      1. אָב֧וֹת'a.VotfathersH0001G
    5. לַלְוִיִּ֛ם
      1. לַlaof theH9005
      2. לְוִיִּ֛םl.vi.YimLevitesH3881
    6. בַּלְּשָׁכֹ֖ת
      1. בַּba.[were] in theH9003
      2. לְּשָׁכֹ֖תle.sha.KhotroomsH3957
    7. פְּטוּרִ֑יםQere, geschrieben (Ketiv): פְּטִירִים
      1. פְּטוּרִ֑יםpe.ti.rimset freeH6362
    8. כִּֽי־
      1. כִּֽיki-forH3588A
    9. יוֹמָ֥ם
      1. יוֹמָ֥םyo.Mamby dayH3119
    10. וָלַ֛יְלָה
      1. וָva.andH9002
      2. לַ֛יְלָהLay.lahnightH3915
    11. עֲלֵיהֶ֖ם
      1. עֲלֵי'a.lei.[was] onH5921A
      2. הֶ֖םHemthemH9038
    12. בַּמְּלָאכָֽה׃
      1. בַּba.in theH9003
      2. מְּלָאכָֽהme.la.KhahworkH4399
  34. 34These were heads of fathers' [ergänzt: houses] of the Levites, throughout their generations, chief men: these dwelt at Jerusalem.
    1. אֵלֶּה֩
      1. אֵלֶּה֩'e.LehtheseH0428
    2. רָאשֵׁ֨י
      1. רָאשֵׁ֨יra.Shei[were] [the] chiefs ofH7218H
    3. הָאָב֧וֹת
      1. הָha.theH9009
      2. אָב֧וֹת'a.VotfathersH0001G
    4. לַלְוִיִּ֛ם
      1. לַlaof theH9005
      2. לְוִיִּ֛םl.vi.YimLevitesH3881
    5. לְתֹלְדוֹתָ֖ם
      1. לְle.toH9005
      2. תֹלְדוֹתָ֖to.le.do.TagenerationsH8435
      3. םmtheirH9028
    6. רָאשִׁ֑ים
      1. רָאשִׁ֑יםra.ShimchiefsH7218H
    7. אֵ֖לֶּה
      1. אֵ֖לֶּה'E.lehtheseH0428
    8. יָשְׁב֥וּ
      1. יָשְׁב֥וּya.she.Vuthey dweltH3427
    9. בִירוּשָׁלִָֽם׃
      1. בִvi.inH9003
      2. ירוּשָׁלִָֽםru.sha.LimJerusalemH3389
  35. 35And in Gibeon there dwelt the father of Gibeon, Jeiel, whose wife's name was Maacah:
    1. וּבְגִבְע֛וֹן
      1. וּu.andH9002
      2. בְve.inH9003
      3. גִבְע֛וֹןgiv.'onGibeonH1391
    2. יָשְׁב֥וּ
      1. יָשְׁב֥וּya.she.Vuthey dweltH3427
    3. אֲבִֽי־
      1. אֲבִֽי'a.vi-[the] father ofH0001I
    4. גִבְע֖וֹן
      1. גִבְע֖וֹןgiv.'onGibeonH1391
    5. יְעִיאֵ֑לQere, geschrieben (Ketiv): יְעוּאֵל
      1. יְעִיאֵ֑לye.'u.'elJeielH3273P
    6. וְשֵׁ֥ם
      1. וְve.andH9002
      2. שֵׁ֥םShem[the] name ofH8034
    7. אִשְׁתּ֖וֹ
      1. אִשְׁתּ֖'ish.TwifeH0802H
      2. וֹohisH9023
    8. מַעֲכָֽה׃
      1. מַעֲכָֽהma.'a.Khah[was] MaacahH4601N
  36. 36and his first-born son Abdon, and Zur, and Kish, and Baal, and Ner, and Nadab,
    1. וּבְנ֥וֹ
      1. וּu.andH9002
      2. בְנ֥ve.NsonH1121A
      3. וֹohisH9023
    2. הַבְּכ֖וֹר
      1. הַha.theH9009
      2. בְּכ֖וֹרbe.KhorfirstbornH1060
    3. עַבְדּ֑וֹן
      1. עַבְדּ֑וֹןav.Don[was] AbdonH5658J
    4. וְצ֣וּר
      1. וְve.andH9002
      2. צ֣וּרTzurZurH6698I
    5. וְקִ֔ישׁ
      1. וְve.andH9002
      2. קִ֔ישׁKishKishH7027G
    6. וּבַ֥עַל
      1. וּu.andH9002
      2. בַ֥עַלVa.'alBaalH1168B
    7. וְנֵ֖ר
      1. וְve.andH9002
      2. נֵ֖רNerNerH5369G
    8. וְנָדָֽב׃
      1. וְve.andH9002
      2. נָדָֽבna.DavNadabH5070J
  37. 37and Gedor, and Ahio, and Zechariah, and Mikloth.
    1. וּגְד֣וֹר
      1. וּu.andH9002
      2. גְד֣וֹרge.DorGedorH1446I
    2. וְאַחְי֔וֹ
      1. וְve.andH9002
      2. אַחְי֔וֹ'ach.YoAhioH0283I
    3. וּזְכַרְיָ֖ה
      1. וּu.andH9002
      2. זְכַרְיָ֖הze.khar.YahZechariahH2148x
    4. וּמִקְלֽוֹת׃
      1. וּu.andH9002
      2. מִקְלֽוֹתmik.LotMiklothH4732G
  38. 38And Mikloth begat Shimeam. And they also dwelt with their brethren in Jerusalem, over against their brethren.
    1. וּמִקְל֖וֹת
      1. וּu.andH9002
      2. מִקְל֖וֹתmik.LotMiklothH4732G
    2. הוֹלִ֣יד
      1. הוֹלִ֣ידho.Lidhe fatheredH3205
    3. אֶת־
      1. אֶת'et-<obj.>H0853
    4. שִׁמְאָ֑ם
      1. שִׁמְאָ֑םshim.'AmShimeamH8043
    5. וְאַף־
      1. וְve.andH9002
      2. אַף'af-alsoH0637
    6. הֵ֗ם
      1. הֵ֗םHemtheyH1992
    7. נֶ֧גֶד
      1. נֶ֧גֶדNe.gedbeforeH5048
    8. אֲחֵיהֶ֛ם
      1. אֲחֵי'a.chei.relativesH0251H
      2. הֶ֛םHemtheirH9028
    9. יָשְׁב֥וּ
      1. יָשְׁב֥וּya.she.Vuthey dweltH3427
    10. בִירֽוּשָׁלִַ֖ם
      1. בִvi.inH9003
      2. ירֽוּשָׁלִַ֖םru.sha.LimJerusalemH3389
    11. עִם־
      1. עִם'im-withH5973A
    12. אֲחֵיהֶֽם׃
      1. אֲחֵי'a.chei.relativesH0251H
      2. הֶֽםHemtheirH9028
  39. 39And Ner begat Kish; and Kish begat Saul; and Saul begat Jonathan, and Malchishua, and Abinadab, and Eshbaal.
    1. וְנֵר֙
      1. וְve.andH9002
      2. נֵר֙NerNerH5369H
    2. הוֹלִ֣יד
      1. הוֹלִ֣ידho.Lidhe fatheredH3205
    3. אֶת־
      1. אֶת'et-<obj.>H0853
    4. קִ֔ישׁ
      1. קִ֔ישׁKishKishH7027G
    5. וְקִ֖ישׁ
      1. וְve.andH9002
      2. קִ֖ישׁKishKishH7027G
    6. הוֹלִ֣יד
      1. הוֹלִ֣ידho.Lidhe fatheredH3205
    7. אֶת־
      1. אֶת'et-<obj.>H0853
    8. שָׁא֑וּל
      1. שָׁא֑וּלsha.'UlSaulH7586G
    9. וְשָׁא֗וּל
      1. וְve.andH9002
      2. שָׁא֗וּלsha.'UlSaulH7586G
    10. הוֹלִ֤יד
      1. הוֹלִ֤ידho.Lidhe fatheredH3205
    11. אֶת־
      1. אֶת'et-<obj.>H0853
    12. יְהֽוֹנָתָן֙
      1. יְהֽוֹנָתָן֙ye.ho.na.TanJonathanH3083H
    13. וְאֶת־
      1. וְve.andH9002
      2. אֶת'Et<obj.>H0853
    14. מַלְכִּי־
      1. מַלְכִּיmal.ki-Malki-H4444
    15. שׁ֔וּעַ
      1. שׁ֔וּעַShu.a'ShuaH4444
    16. וְאֶת־
      1. וְve.andH9002
      2. אֶת'Et<obj.>H0853
    17. אֲבִינָדָ֖ב
      1. אֲבִינָדָ֖ב'a.vi.na.DavAbinadabH0041H
    18. וְאֶת־
      1. וְve.andH9002
      2. אֶת'Et<obj.>H0853
    19. אֶשְׁבָּֽעַל׃
      1. אֶשְׁבָּֽעַל'esh.Ba.'alEshbaalH0792
  40. 40And the son of Jonathan was Merib-baal; and Merib-baal begat Micah.
    1. וּבֶן־
      1. וּu.andH9002
      2. בֶןven-[the] son ofH1121A
    2. יְהוֹנָתָ֖ן
      1. יְהוֹנָתָ֖ןye.ho.na.TanJonathanH3083H
    3. מְרִ֣יב
      1. מְרִ֣יבme.Riv[was] Merib-H4807
    4. בָּ֑עַל
      1. בָּ֑עַלBa.'al-baalH4807
    5. וּמְרִי־
      1. וּu.andH9002
      2. מְרִיme.ri-Meri-H4810
    6. בַ֖עַל
      1. בַ֖עַלVa.'al-baalH4810
    7. הוֹלִ֥יד
      1. הוֹלִ֥ידho.Lidhe fatheredH3205
    8. אֶת־
      1. אֶת'et-<obj.>H0853
    9. מִיכָֽה׃
      1. מִיכָֽהmi.KhahMicahH4318H
  41. 41And the sons of Micah: Pithon, and Melech, and Tahrea, [ergänzt: and Ahaz].
    1. וּבְנֵ֖י
      1. וּu.andH9002
      2. בְנֵ֖יve.Nei[the] sons ofH1121A
    2. מִיכָ֑ה
      1. מִיכָ֑הmi.KhahMicahH4318H
    3. פִּית֥וֹן
      1. פִּית֥וֹןpi.TonPithonH6377
    4. וָמֶ֖לֶךְ
      1. וָva.andH9002
      2. מֶ֖לֶךְMe.lekhMelechH4429
    5. וְתַחְרֵֽעַ׃
      1. וְve.andH9002
      2. תַחְרֵֽעַtach.Re.a'TahreaH8475
    6. וְאָחָֽז׃aus der Septuaginta
      1. וְve.andH9002
      2. אָחָֽז'a.ChazAhazH0271H
  42. 42And Ahaz begat Jarah; and Jarah begat Alemeth, and Azmaveth, and Zimri; and Zimri begat Moza;
    1. וְאָחָז֙
      1. וְve.andH9002
      2. אָחָז֙'a.ChazAhazH0271H
    2. הוֹלִ֣יד
      1. הוֹלִ֣ידho.Lidhe fatheredH3205
    3. אֶת־
      1. אֶת'et-<obj.>H0853
    4. יַעְרָ֔ה
      1. יַעְרָ֔הya'.RahJarahH3294
    5. וְיַעְרָ֗ה
      1. וְve.andH9002
      2. יַעְרָ֗הya'.RahJarahH3294
    6. הוֹלִ֛יד
      1. הוֹלִ֛ידho.Lidhe fatheredH3205
    7. אֶת־
      1. אֶת'et-<obj.>H0853
    8. עָלֶ֥מֶת
      1. עָלֶ֥מֶת'a.Le.metAlemethH5964I
    9. וְאֶת־
      1. וְve.andH9002
      2. אֶת'Et<obj.>H0853
    10. עַזְמָ֖וֶת
      1. עַזְמָ֖וֶת'az.Ma.vetAzmavethH5820H
    11. וְאֶת־
      1. וְve.andH9002
      2. אֶת'Et<obj.>H0853
    12. זִמְרִ֑י
      1. זִמְרִ֑יzim.RiZimriH2174H
    13. וְזִמְרִ֖י
      1. וְve.andH9002
      2. זִמְרִ֖יzim.RiZimriH2174H
    14. הוֹלִ֥יד
      1. הוֹלִ֥ידho.Lidhe fatheredH3205
    15. אֶת־
      1. אֶת'et-<obj.>H0853
    16. מוֹצָֽא׃
      1. מוֹצָֽאmo.Tza'MozaH4162H
  43. 43and Moza begat Binea; and Rephaiah his son, Eleasah his son, Azel his son.
    1. וּמוֹצָ֖א
      1. וּu.andH9002
      2. מוֹצָ֖אmo.Tza'MozaH4162H
    2. הוֹלִ֣יד
      1. הוֹלִ֣ידho.Lidhe fatheredH3205
    3. אֶת־
      1. אֶת'et-<obj.>H0853
    4. בִּנְעָ֑א
      1. בִּנְעָ֑אbin.'A'BineaH1150
    5. וּרְפָיָ֥ה
      1. וּu.andH9002
      2. רְפָיָ֥הre.fa.YahRephaiahH7509K
    6. בְנ֛וֹ
      1. בְנ֛ve.NsonH1121A
      2. וֹohisH9023
    7. אֶלְעָשָׂ֥ה
      1. אֶלְעָשָׂ֥ה'el.'a.SahEleasahH0501H
    8. בְנ֖וֹ
      1. בְנ֖ve.NsonH1121A
      2. וֹohisH9023
    9. אָצֵ֥ל
      1. אָצֵ֥ל'a.TzelAzelH0682A
    10. בְּנֽוֹ׃
      1. בְּנֽbe.NsonH1121A
      2. וֹohisH9023
  44. 44And Azel had six sons, whose names are these: Azrikam, Bocheru, and Ishmael, and Sheariah, and Obadiah, and Hanan: these were the sons of Azel.
    1. וּלְאָצֵל֮
      1. וּu.andH9002
      2. לְle.[belonged] toH9005
      3. אָצֵל֮'a.TzelAzelH0682A
    2. שִׁשָּׁ֣ה
      1. שִׁשָּׁ֣הshi.ShahsixH8337
    3. בָנִים֒
      1. בָנִים֒va.NimsonsH1121A
    4. וְאֵ֣לֶּה
      1. וְve.andH9002
      2. אֵ֣לֶּה'E.lehtheseH0428
    5. שְׁמוֹתָ֗ם
      1. שְׁמוֹתָ֗she.mo.Ta[are] namesH8034
      2. םmtheirH9028
    6. עַזְרִיקָ֥ם׀
      1. עַזְרִיקָ֥ם'az.ri.KamAzrikamH5840H
    7. בֹּ֙כְרוּ֙
      1. בֹּ֙כְרוּ֙bo.khe.ruBocheruH1074
    8. וְיִשְׁמָעֵ֣אל
      1. וְve.andH9002
      2. יִשְׁמָעֵ֣אלyish.ma.'ElIshmaelH3458I
    9. וּשְׁעַרְיָ֔ה
      1. וּu.andH9002
      2. שְׁעַרְיָ֔הshe.'ar.YahSheariahH8187
    10. וְעֹבַדְיָ֖ה
      1. וְve.andH9002
      2. עֹבַדְיָ֖ה'oad.YahObadiahH5662J
    11. וְחָנָ֑ן
      1. וְve.andH9002
      2. חָנָ֑ןcha.NanHananH2605H
    12. אֵ֖לֶּה
      1. אֵ֖לֶּה'E.lehtheseH0428
    13. בְּנֵ֥י
      1. בְּנֵ֥יbe.Nei[were] [the] sons ofH1121A
    14. אָצַֽל׃
      1. אָצַֽל'a.TzalAzelH0682A

Kursiv gesetzte Wörter haben die Übersetzer ergänzt.

Public Domain